C16H23NO3S — CID 42961400
N-cyclopentyl-2-[(2-methylphenyl)methylsulfonyl]propanamide (PubChem CID 42961400) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is N-cyclopentyl-2-[(2-methylphenyl)methylsulfonyl]propanamide.
| Compound Name | N-cyclopentyl-2-[(2-methylphenyl)methylsulfonyl]propanamide |
|---|---|
| PubChem CID | 42961400 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-cyclopentyl-2-[(2-methylphenyl)methylsulfonyl]propanamide |
| SMILES | Cc1ccccc1CS(=O)(=O)C(C)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H23NO3S/c1-12-7-3-4-8-14(12)11-21(19,20)13(2)16(18)17-15-9-5-6-10-15/h3-4,7-8,13,15H,5-6,9-11H2,1-2H3,(H,17,18) |
| InChIKey | WRJBAPYLLANBRW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |