C16H21ClFNO3S — CID 51727076
(2R)-2-[(2-chloro-4-fluorophenyl)methylsulfonyl]-N-cyclohexylpropanamide (PubChem CID 51727076) has the molecular formula C16H21ClFNO3S and a molecular weight of 361.87 g/mol. Its IUPAC name is (2R)-2-[(2-chloro-4-fluorophenyl)methylsulfonyl]-N-cyclohexylpropanamide.
| Compound Name | (2R)-2-[(2-chloro-4-fluorophenyl)methylsulfonyl]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 51727076 |
| Molecular Formula | C16H21ClFNO3S |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (2R)-2-[(2-chloro-4-fluorophenyl)methylsulfonyl]-N-cyclohexylpropanamide |
| SMILES | C[C@H](C(=O)NC1CCCCC1)S(=O)(=O)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H21ClFNO3S/c1-11(16(20)19-14-5-3-2-4-6-14)23(21,22)10-12-7-8-13(18)9-15(12)17/h7-9,11,14H,2-6,10H2,1H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | SYZROULIWCZIBG-LLVKDONJSA-N |
| XLogP | 3.23 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |