C11H13ClFNO3S — CID 51946888
(2S)-2-[(2-chloro-4-fluorophenyl)methylsulfonyl]-N-methylpropanamide (PubChem CID 51946888) has the molecular formula C11H13ClFNO3S and a molecular weight of 293.75 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-4-fluorophenyl)methylsulfonyl]-N-methylpropanamide.
| Compound Name | (2S)-2-[(2-chloro-4-fluorophenyl)methylsulfonyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 51946888 |
| Molecular Formula | C11H13ClFNO3S |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | (2S)-2-[(2-chloro-4-fluorophenyl)methylsulfonyl]-N-methylpropanamide |
| SMILES | CNC(=O)[C@H](C)S(=O)(=O)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C11H13ClFNO3S/c1-7(11(15)14-2)18(16,17)6-8-3-4-9(13)5-10(8)12/h3-5,7H,6H2,1-2H3,(H,14,15)/t7-/m0/s1 |
| InChIKey | ADNTUQFNPWKVAA-ZETCQYMHSA-N |
| XLogP | 1.53 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |