About 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride
2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride (PubChem CID 159873600) has the molecular formula C14H10Cl4F2O2S
and a molecular weight of 422.11 g/mol. Its IUPAC name is 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride.
Molecular Properties
| Compound Name | 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride |
| PubChem CID | 159873600 |
| Molecular Formula | C14H10Cl4F2O2S |
| Molecular Weight | 422.11 g/mol |
| Exact Mass | 419.91 |
| IUPAC Name | 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride |
| SMILES | Fc1ccc(CCl)c(Cl)c1.O=S(=O)(Cl)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C7H5Cl2FO2S.C7H5Cl2F/c8-7-3-6(10)2-1-5(7)4-13(9,11)12;8-4-5-1-2-6(10)3-7(5)9/h1-3H,4H2;1-3H,4H2 |
| InChIKey | NSPUIDNKAOJCNN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.11 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride?
The IUPAC name of 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride (CID 159873600) is 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride.
What is the SMILES notation for 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride?
The canonical SMILES for 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride is Fc1ccc(CCl)c(Cl)c1.O=S(=O)(Cl)Cc1ccc(F)cc1Cl.
What is the InChIKey of 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride?
The InChIKey is NSPUIDNKAOJCNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2FO2S.C7H5Cl2F/c8-7-3-6(10)2-1-5(7)4-13(9,11)12;8-4-5-1-2-6(10)3-7(5)9/h1-3H,4H2;1-3H,4H2.
What are the key properties of 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride?
2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride has a molecular weight of 422.11 g/mol, XLogP of 5.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-(chloromethyl)-4-fluorobenzene;(2-chloro-4-fluorophenyl)methanesulfonyl chloride is sourced from PubChem (CID 159873600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).