C17H18ClFO3S — CID 87024513
2-chloro-4-fluoro-1-[(2-propan-2-yloxyphenyl)methylsulfonylmethyl]benzene (PubChem CID 87024513) has the molecular formula C17H18ClFO3S and a molecular weight of 356.85 g/mol. Its IUPAC name is 2-chloro-4-fluoro-1-[(2-propan-2-yloxyphenyl)methylsulfonylmethyl]benzene.
| Compound Name | 2-chloro-4-fluoro-1-[(2-propan-2-yloxyphenyl)methylsulfonylmethyl]benzene |
|---|---|
| PubChem CID | 87024513 |
| Molecular Formula | C17H18ClFO3S |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-chloro-4-fluoro-1-[(2-propan-2-yloxyphenyl)methylsulfonylmethyl]benzene |
| SMILES | CC(C)Oc1ccccc1CS(=O)(=O)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H18ClFO3S/c1-12(2)22-17-6-4-3-5-14(17)11-23(20,21)10-13-7-8-15(19)9-16(13)18/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | ZTGNIHSMGDGKER-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |