C16H14ClF2NOS — CID 42942830
2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-N-(2-fluorophenyl)propanamide (PubChem CID 42942830) has the molecular formula C16H14ClF2NOS and a molecular weight of 341.81 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-N-(2-fluorophenyl)propanamide.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 42942830 |
| Molecular Formula | C16H14ClF2NOS |
| Molecular Weight | 341.81 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-N-(2-fluorophenyl)propanamide |
| SMILES | CC(SCc1ccc(F)cc1Cl)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C16H14ClF2NOS/c1-10(16(21)20-15-5-3-2-4-14(15)19)22-9-11-6-7-12(18)8-13(11)17/h2-8,10H,9H2,1H3,(H,20,21) |
| InChIKey | WNXMAYKISWLWPC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.81 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |