C17H18ClNO2S — CID 94038326
(2R)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2-methoxyphenyl)propanamide (PubChem CID 94038326) has the molecular formula C17H18ClNO2S and a molecular weight of 335.86 g/mol. Its IUPAC name is (2R)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2-methoxyphenyl)propanamide.
| Compound Name | (2R)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 94038326 |
| Molecular Formula | C17H18ClNO2S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | (2R)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1NC(=O)[C@@H](C)SCc1ccccc1Cl |
| InChI | InChI=1S/C17H18ClNO2S/c1-12(22-11-13-7-3-4-8-14(13)18)17(20)19-15-9-5-6-10-16(15)21-2/h3-10,12H,11H2,1-2H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | VWMSVBZWDNSZGS-GFCCVEGCSA-N |
| XLogP | 4.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |