C7H4Cl2F2O2S — CID 84806660
(3-chloro-2,4-difluorophenyl)methanesulfonyl chloride (PubChem CID 84806660) has the molecular formula C7H4Cl2F2O2S and a molecular weight of 261.08 g/mol. Its IUPAC name is (3-chloro-2,4-difluorophenyl)methanesulfonyl chloride.
| Compound Name | (3-chloro-2,4-difluorophenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 84806660 |
| Molecular Formula | C7H4Cl2F2O2S |
| Molecular Weight | 261.08 g/mol |
| Exact Mass | 259.93 |
| IUPAC Name | (3-chloro-2,4-difluorophenyl)methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)Cc1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C7H4Cl2F2O2S/c8-6-5(10)2-1-4(7(6)11)3-14(9,12)13/h1-2H,3H2 |
| InChIKey | CKJCDCMPRKWKRR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.08 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|