C7H3BrClF3O2S — CID 117117336
(3-bromo-2,4,5-trifluorophenyl)methanesulfonyl chloride (PubChem CID 117117336) has the molecular formula C7H3BrClF3O2S and a molecular weight of 323.52 g/mol. Its IUPAC name is (3-bromo-2,4,5-trifluorophenyl)methanesulfonyl chloride.
| Compound Name | (3-bromo-2,4,5-trifluorophenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 117117336 |
| Molecular Formula | C7H3BrClF3O2S |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 321.87 |
| IUPAC Name | (3-bromo-2,4,5-trifluorophenyl)methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)Cc1cc(F)c(F)c(Br)c1F |
| InChI | InChI=1S/C7H3BrClF3O2S/c8-5-6(11)3(2-15(9,13)14)1-4(10)7(5)12/h1H,2H2 |
| InChIKey | NSDHFPZXQFVBJO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|