C9H6BrF3O — CID 117115023
1-(3-bromo-2,4,5-trifluorophenyl)propan-2-one (PubChem CID 117115023) has the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. Its IUPAC name is 1-(3-bromo-2,4,5-trifluorophenyl)propan-2-one.
| Compound Name | 1-(3-bromo-2,4,5-trifluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 117115023 |
| Molecular Formula | C9H6BrF3O |
| Molecular Weight | 267.04 g/mol |
| Exact Mass | 265.96 |
| IUPAC Name | 1-(3-bromo-2,4,5-trifluorophenyl)propan-2-one |
| SMILES | CC(=O)Cc1cc(F)c(F)c(Br)c1F |
| InChI | InChI=1S/C9H6BrF3O/c1-4(14)2-5-3-6(11)9(13)7(10)8(5)12/h3H,2H2,1H3 |
| InChIKey | CSTREPXXVYGEEP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.04 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|