C10H7F3O3 — CID 117335713
2,3,6-trifluoro-4-(2-oxopropyl)benzoic acid (PubChem CID 117335713) has the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. Its IUPAC name is 2,3,6-trifluoro-4-(2-oxopropyl)benzoic acid.
| Compound Name | 2,3,6-trifluoro-4-(2-oxopropyl)benzoic acid |
|---|---|
| PubChem CID | 117335713 |
| Molecular Formula | C10H7F3O3 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2,3,6-trifluoro-4-(2-oxopropyl)benzoic acid |
| SMILES | CC(=O)Cc1cc(F)c(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C10H7F3O3/c1-4(14)2-5-3-6(11)7(10(15)16)9(13)8(5)12/h3H,2H2,1H3,(H,15,16) |
| InChIKey | UWBNQLJJVIGSGQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|