2,3,4,5,6-pentafluoro(13C)benzoic acid

C7HF5O2 — CID 171380486

IUPAC2,3,4,5,6-pentafluoro(13C)benzoic acid
SMILESO=[13C](O)c1c(F)c(F)c(F)c(F)c1F
InChIInChI=1S/C7HF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h(H,13,14)/i7+1
InChIKeyYZERDTREOUSUHF-CDYZYAPPSA-N
MW213.07 g/mol
LogP2.08
Rot. Bonds1

About 2,3,4,5,6-pentafluoro(13C)benzoic acid

2,3,4,5,6-pentafluoro(13C)benzoic acid (PubChem CID 171380486) has the molecular formula C7HF5O2 and a molecular weight of 213.07 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro(13C)benzoic acid.

Molecular Properties

Compound Name2,3,4,5,6-pentafluoro(13C)benzoic acid
PubChem CID171380486
Molecular FormulaC7HF5O2
Molecular Weight213.07 g/mol
Exact Mass212.99
IUPAC Name2,3,4,5,6-pentafluoro(13C)benzoic acid
SMILESO=[13C](O)c1c(F)c(F)c(F)c(F)c1F
InChIInChI=1S/C7HF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h(H,13,14)/i7+1
InChIKeyYZERDTREOUSUHF-CDYZYAPPSA-N
XLogP2.08
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.07
LogP ≤ 52.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2,3,4,5,6-pentafluoro(13C)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3,4,5,6-pentafluoro(13C)benzoic acid?
The IUPAC name of 2,3,4,5,6-pentafluoro(13C)benzoic acid (CID 171380486) is 2,3,4,5,6-pentafluoro(13C)benzoic acid.
What is the SMILES notation for 2,3,4,5,6-pentafluoro(13C)benzoic acid?
The canonical SMILES for 2,3,4,5,6-pentafluoro(13C)benzoic acid is O=[13C](O)c1c(F)c(F)c(F)c(F)c1F.
What is the InChIKey of 2,3,4,5,6-pentafluoro(13C)benzoic acid?
The InChIKey is YZERDTREOUSUHF-CDYZYAPPSA-N. The full InChI is InChI=1S/C7HF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h(H,13,14)/i7+1.
What are the key properties of 2,3,4,5,6-pentafluoro(13C)benzoic acid?
2,3,4,5,6-pentafluoro(13C)benzoic acid has a molecular weight of 213.07 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5,6-pentafluoro(13C)benzoic acid is sourced from PubChem (CID 171380486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).