C17H4F6O9 — CID 19891320
3-(2,3-dicarboxy-4,5,6-trifluorobenzoyl)-4,5,6-trifluorophthalic acid (PubChem CID 19891320) has the molecular formula C17H4F6O9 and a molecular weight of 466.20 g/mol. Its IUPAC name is 3-(2,3-dicarboxy-4,5,6-trifluorobenzoyl)-4,5,6-trifluorophthalic acid.
| Compound Name | 3-(2,3-dicarboxy-4,5,6-trifluorobenzoyl)-4,5,6-trifluorophthalic acid |
|---|---|
| PubChem CID | 19891320 |
| Molecular Formula | C17H4F6O9 |
| Molecular Weight | 466.20 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | 3-(2,3-dicarboxy-4,5,6-trifluorobenzoyl)-4,5,6-trifluorophthalic acid |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(C(=O)c2c(F)c(F)c(F)c(C(=O)O)c2C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C17H4F6O9/c18-7-3(1(14(25)26)5(16(29)30)9(20)11(7)22)13(24)4-2(15(27)28)6(17(31)32)10(21)12(23)8(4)19/h(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | DLYUBJAIFJQLNM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|