C8H2ClF3O4 — CID 87123234
2-chloro-3,5,6-trifluoroterephthalic acid (PubChem CID 87123234) has the molecular formula C8H2ClF3O4 and a molecular weight of 254.55 g/mol. Its IUPAC name is 2-chloro-3,5,6-trifluoroterephthalic acid.
| Compound Name | 2-chloro-3,5,6-trifluoroterephthalic acid |
|---|---|
| PubChem CID | 87123234 |
| Molecular Formula | C8H2ClF3O4 |
| Molecular Weight | 254.55 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 2-chloro-3,5,6-trifluoroterephthalic acid |
| SMILES | O=C(O)c1c(F)c(F)c(C(=O)O)c(Cl)c1F |
| InChI | InChI=1S/C8H2ClF3O4/c9-3-1(7(13)14)5(11)6(12)2(4(3)10)8(15)16/h(H,13,14)(H,15,16) |
| InChIKey | IFQOQJVOFGOGKV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|