C14H2CdF10O4 — CID 135046490
cadmium;bis(2,3,4,5,6-pentafluorobenzoic acid) (PubChem CID 135046490) has the molecular formula C14H2CdF10O4 and a molecular weight of 536.56 g/mol. Its IUPAC name is cadmium;bis(2,3,4,5,6-pentafluorobenzoic acid).
| Compound Name | cadmium;bis(2,3,4,5,6-pentafluorobenzoic acid) |
|---|---|
| PubChem CID | 135046490 |
| Molecular Formula | C14H2CdF10O4 |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 537.88 |
| IUPAC Name | cadmium;bis(2,3,4,5,6-pentafluorobenzoic acid) |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1F.O=C(O)c1c(F)c(F)c(F)c(F)c1F.[Cd] |
| InChI | InChI=1S/2C7HF5O2.Cd/c2*8-2-1(7(13)14)3(9)5(11)6(12)4(2)10;/h2*(H,13,14); |
| InChIKey | KKXNQOYWBUHJPZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|