C7HClF5MgO2+ — CID 173268158
magnesium;2,3,4,5,6-pentafluorobenzoic acid;chloride (PubChem CID 173268158) has the molecular formula C7HClF5MgO2+ and a molecular weight of 271.83 g/mol. Its IUPAC name is magnesium;2,3,4,5,6-pentafluorobenzoic acid;chloride.
| Compound Name | magnesium;2,3,4,5,6-pentafluorobenzoic acid;chloride |
|---|---|
| PubChem CID | 173268158 |
| Molecular Formula | C7HClF5MgO2+ |
| Molecular Weight | 271.83 g/mol |
| Exact Mass | 270.94 |
| IUPAC Name | magnesium;2,3,4,5,6-pentafluorobenzoic acid;chloride |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1F.[Cl-].[Mg+2] |
| InChI | InChI=1S/C7HF5O2.ClH.Mg/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10;;/h(H,13,14);1H;/q;;+2/p-1 |
| InChIKey | XOPQNOUKENXPHL-UHFFFAOYSA-M |
| XLogP | -1.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.83 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|