C9H6F4O — CID 117294401
1-(2,3,5,6-tetrafluorophenyl)propan-2-one (PubChem CID 117294401) has the molecular formula C9H6F4O and a molecular weight of 206.14 g/mol. Its IUPAC name is 1-(2,3,5,6-tetrafluorophenyl)propan-2-one.
| Compound Name | 1-(2,3,5,6-tetrafluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 117294401 |
| Molecular Formula | C9H6F4O |
| Molecular Weight | 206.14 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 1-(2,3,5,6-tetrafluorophenyl)propan-2-one |
| SMILES | CC(=O)Cc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C9H6F4O/c1-4(14)2-5-8(12)6(10)3-7(11)9(5)13/h3H,2H2,1H3 |
| InChIKey | RDJUFUZLMSUVBC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.14 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|