C9H8ClFO3 — CID 84786403
1-(5-chloro-2-fluoro-3,6-dihydroxyphenyl)propan-2-one (PubChem CID 84786403) has the molecular formula C9H8ClFO3 and a molecular weight of 218.61 g/mol. Its IUPAC name is 1-(5-chloro-2-fluoro-3,6-dihydroxyphenyl)propan-2-one.
| Compound Name | 1-(5-chloro-2-fluoro-3,6-dihydroxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 84786403 |
| Molecular Formula | C9H8ClFO3 |
| Molecular Weight | 218.61 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 1-(5-chloro-2-fluoro-3,6-dihydroxyphenyl)propan-2-one |
| SMILES | CC(=O)Cc1c(O)c(Cl)cc(O)c1F |
| InChI | InChI=1S/C9H8ClFO3/c1-4(12)2-5-8(11)7(13)3-6(10)9(5)14/h3,13-14H,2H2,1H3 |
| InChIKey | ZZIVDOQVCSULID-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.61 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|