C9H7ClF2O2 — CID 117314974
1-(3-chloro-2,5-difluoro-6-hydroxyphenyl)propan-2-one (PubChem CID 117314974) has the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. Its IUPAC name is 1-(3-chloro-2,5-difluoro-6-hydroxyphenyl)propan-2-one.
| Compound Name | 1-(3-chloro-2,5-difluoro-6-hydroxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 117314974 |
| Molecular Formula | C9H7ClF2O2 |
| Molecular Weight | 220.60 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 1-(3-chloro-2,5-difluoro-6-hydroxyphenyl)propan-2-one |
| SMILES | CC(=O)Cc1c(O)c(F)cc(Cl)c1F |
| InChI | InChI=1S/C9H7ClF2O2/c1-4(13)2-5-8(12)6(10)3-7(11)9(5)14/h3,14H,2H2,1H3 |
| InChIKey | AETZHKPFZDQBIE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|