C10H9ClF2O2 — CID 117341308
4-chloro-3,6-difluoro-2-[(1-hydroxycyclopropyl)methyl]phenol (PubChem CID 117341308) has the molecular formula C10H9ClF2O2 and a molecular weight of 234.63 g/mol. Its IUPAC name is 4-chloro-3,6-difluoro-2-[(1-hydroxycyclopropyl)methyl]phenol.
| Compound Name | 4-chloro-3,6-difluoro-2-[(1-hydroxycyclopropyl)methyl]phenol |
|---|---|
| PubChem CID | 117341308 |
| Molecular Formula | C10H9ClF2O2 |
| Molecular Weight | 234.63 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 4-chloro-3,6-difluoro-2-[(1-hydroxycyclopropyl)methyl]phenol |
| SMILES | Oc1c(F)cc(Cl)c(F)c1CC1(O)CC1 |
| InChI | InChI=1S/C10H9ClF2O2/c11-6-3-7(12)9(14)5(8(6)13)4-10(15)1-2-10/h3,14-15H,1-2,4H2 |
| InChIKey | IUZXQUAIKUDYNR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.63 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|