C9H8ClFO4 — CID 84797143
2-(5-chloro-2-fluoro-6-hydroxy-3-methoxyphenyl)acetic acid (PubChem CID 84797143) has the molecular formula C9H8ClFO4 and a molecular weight of 234.61 g/mol. Its IUPAC name is 2-(5-chloro-2-fluoro-6-hydroxy-3-methoxyphenyl)acetic acid.
| Compound Name | 2-(5-chloro-2-fluoro-6-hydroxy-3-methoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 84797143 |
| Molecular Formula | C9H8ClFO4 |
| Molecular Weight | 234.61 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 2-(5-chloro-2-fluoro-6-hydroxy-3-methoxyphenyl)acetic acid |
| SMILES | COc1cc(Cl)c(O)c(CC(=O)O)c1F |
| InChI | InChI=1S/C9H8ClFO4/c1-15-6-3-5(10)9(14)4(8(6)11)2-7(12)13/h3,14H,2H2,1H3,(H,12,13) |
| InChIKey | PJHRBWPXKIWKPT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.61 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |