C11H12F2O4 — CID 18444799
2-(3-ethoxy-2,6-difluoro-5-methoxyphenyl)acetic acid (PubChem CID 18444799) has the molecular formula C11H12F2O4 and a molecular weight of 246.21 g/mol. Its IUPAC name is 2-(3-ethoxy-2,6-difluoro-5-methoxyphenyl)acetic acid.
| Compound Name | 2-(3-ethoxy-2,6-difluoro-5-methoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 18444799 |
| Molecular Formula | C11H12F2O4 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-(3-ethoxy-2,6-difluoro-5-methoxyphenyl)acetic acid |
| SMILES | CCOc1cc(OC)c(F)c(CC(=O)O)c1F |
| InChI | InChI=1S/C11H12F2O4/c1-3-17-8-5-7(16-2)10(12)6(11(8)13)4-9(14)15/h5H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | CYMXLAYOTLDXEJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |