C9H8ClFO4 — CID 84797137
3-(5-chloro-2-fluoro-3,6-dihydroxyphenyl)propanoic acid (PubChem CID 84797137) has the molecular formula C9H8ClFO4 and a molecular weight of 234.61 g/mol. Its IUPAC name is 3-(5-chloro-2-fluoro-3,6-dihydroxyphenyl)propanoic acid.
| Compound Name | 3-(5-chloro-2-fluoro-3,6-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 84797137 |
| Molecular Formula | C9H8ClFO4 |
| Molecular Weight | 234.61 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 3-(5-chloro-2-fluoro-3,6-dihydroxyphenyl)propanoic acid |
| SMILES | O=C(O)CCc1c(O)c(Cl)cc(O)c1F |
| InChI | InChI=1S/C9H8ClFO4/c10-5-3-6(12)8(11)4(9(5)15)1-2-7(13)14/h3,12,15H,1-2H2,(H,13,14) |
| InChIKey | SJYHKGDYDCXTIY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.61 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|