C9H8BrFO3 — CID 84807152
3-(6-bromo-2-fluoro-3-hydroxyphenyl)propanoic acid (PubChem CID 84807152) has the molecular formula C9H8BrFO3 and a molecular weight of 263.06 g/mol. Its IUPAC name is 3-(6-bromo-2-fluoro-3-hydroxyphenyl)propanoic acid.
| Compound Name | 3-(6-bromo-2-fluoro-3-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 84807152 |
| Molecular Formula | C9H8BrFO3 |
| Molecular Weight | 263.06 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 3-(6-bromo-2-fluoro-3-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)CCc1c(Br)ccc(O)c1F |
| InChI | InChI=1S/C9H8BrFO3/c10-6-2-3-7(12)9(11)5(6)1-4-8(13)14/h2-3,12H,1,4H2,(H,13,14) |
| InChIKey | ZFIVJVUMIVHBCN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.06 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |