3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid

C9H8F2O3 — CID 84776661

IUPAC3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid
SMILESO=C(O)CCc1c(O)cc(F)cc1F
InChIInChI=1S/C9H8F2O3/c10-5-3-7(11)6(8(12)4-5)1-2-9(13)14/h3-4,12H,1-2H2,(H,13,14)
InChIKeyZLNCRVRGTJUYAU-UHFFFAOYSA-N
MW202.16 g/mol
LogP1.69
Rot. Bonds3

About 3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid

3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid (PubChem CID 84776661) has the molecular formula C9H8F2O3 and a molecular weight of 202.16 g/mol. Its IUPAC name is 3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid.

Molecular Properties

Compound Name3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid
PubChem CID84776661
Molecular FormulaC9H8F2O3
Molecular Weight202.16 g/mol
Exact Mass202.04
IUPAC Name3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid
SMILESO=C(O)CCc1c(O)cc(F)cc1F
InChIInChI=1S/C9H8F2O3/c10-5-3-7(11)6(8(12)4-5)1-2-9(13)14/h3-4,12H,1-2H2,(H,13,14)
InChIKeyZLNCRVRGTJUYAU-UHFFFAOYSA-N
XLogP1.69
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.16
LogP ≤ 51.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid?
The IUPAC name of 3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid (CID 84776661) is 3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid.
What is the SMILES notation for 3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid?
The canonical SMILES for 3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid is O=C(O)CCc1c(O)cc(F)cc1F.
What is the InChIKey of 3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid?
The InChIKey is ZLNCRVRGTJUYAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2O3/c10-5-3-7(11)6(8(12)4-5)1-2-9(13)14/h3-4,12H,1-2H2,(H,13,14).
What are the key properties of 3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid?
3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid has a molecular weight of 202.16 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-difluoro-6-hydroxyphenyl)propanoic acid is sourced from PubChem (CID 84776661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).