C7H4BrClF2O2S — CID 117490895
(3-bromo-2,5-difluorophenyl)methanesulfonyl chloride (PubChem CID 117490895) has the molecular formula C7H4BrClF2O2S and a molecular weight of 305.53 g/mol. Its IUPAC name is (3-bromo-2,5-difluorophenyl)methanesulfonyl chloride.
| Compound Name | (3-bromo-2,5-difluorophenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 117490895 |
| Molecular Formula | C7H4BrClF2O2S |
| Molecular Weight | 305.53 g/mol |
| Exact Mass | 303.88 |
| IUPAC Name | (3-bromo-2,5-difluorophenyl)methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)Cc1cc(F)cc(Br)c1F |
| InChI | InChI=1S/C7H4BrClF2O2S/c8-6-2-5(10)1-4(7(6)11)3-14(9,12)13/h1-2H,3H2 |
| InChIKey | NCFVCCRAVCYBAS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|