C7H5BrF2O — CID 66657412
(3-bromo-2,5-difluorophenyl)methanol (PubChem CID 66657412) has the molecular formula C7H5BrF2O and a molecular weight of 223.02 g/mol. Its IUPAC name is (3-bromo-2,5-difluorophenyl)methanol.
| Compound Name | (3-bromo-2,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 66657412 |
| Molecular Formula | C7H5BrF2O |
| Molecular Weight | 223.02 g/mol |
| Exact Mass | 221.95 |
| IUPAC Name | (3-bromo-2,5-difluorophenyl)methanol |
| SMILES | OCc1cc(F)cc(Br)c1F |
| InChI | InChI=1S/C7H5BrF2O/c8-6-2-5(9)1-4(3-11)7(6)10/h1-2,11H,3H2 |
| InChIKey | MHTYZAZJJICWHX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.02 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|