C7H5Br2FO — CID 58043943
(2,6-dibromo-4-fluorophenyl)methanol (PubChem CID 58043943) has the molecular formula C7H5Br2FO and a molecular weight of 283.92 g/mol. Its IUPAC name is (2,6-dibromo-4-fluorophenyl)methanol.
| Compound Name | (2,6-dibromo-4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 58043943 |
| Molecular Formula | C7H5Br2FO |
| Molecular Weight | 283.92 g/mol |
| Exact Mass | 281.87 |
| IUPAC Name | (2,6-dibromo-4-fluorophenyl)methanol |
| SMILES | OCc1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C7H5Br2FO/c8-6-1-4(10)2-7(9)5(6)3-11/h1-2,11H,3H2 |
| InChIKey | FQRVRSIZRGCUQG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.92 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |