C10H9Br2FO — CID 170477624
4-(2,6-dibromo-4-fluorophenyl)but-3-en-1-ol (PubChem CID 170477624) has the molecular formula C10H9Br2FO and a molecular weight of 323.99 g/mol. Its IUPAC name is 4-(2,6-dibromo-4-fluorophenyl)but-3-en-1-ol.
| Compound Name | 4-(2,6-dibromo-4-fluorophenyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 170477624 |
| Molecular Formula | C10H9Br2FO |
| Molecular Weight | 323.99 g/mol |
| Exact Mass | 321.90 |
| IUPAC Name | 4-(2,6-dibromo-4-fluorophenyl)but-3-en-1-ol |
| SMILES | OCCC=Cc1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C10H9Br2FO/c11-9-5-7(13)6-10(12)8(9)3-1-2-4-14/h1,3,5-6,14H,2,4H2 |
| InChIKey | NPDJIDCGGDWTMK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.99 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |