C10H11F2NO — CID 170476606
4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol (PubChem CID 170476606) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol.
| Compound Name | 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 170476606 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol |
| SMILES | Nc1c(F)cc(F)cc1C=CCCO |
| InChI | InChI=1S/C10H11F2NO/c11-8-5-7(3-1-2-4-14)10(13)9(12)6-8/h1,3,5-6,14H,2,4,13H2 |
| InChIKey | FKJABYSGAYXOAA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|