About 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol
4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol (PubChem CID 170476606) has the molecular formula C10H11F2NO
and a molecular weight of 199.20 g/mol. Its IUPAC name is 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol.
Molecular Properties
| Compound Name | 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol |
| PubChem CID | 170476606 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol |
| SMILES | Nc1c(F)cc(F)cc1C=CCCO |
| InChI | InChI=1S/C10H11F2NO/c11-8-5-7(3-1-2-4-14)10(13)9(12)6-8/h1,3,5-6,14H,2,4,13H2 |
| InChIKey | FKJABYSGAYXOAA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol?
The IUPAC name of 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol (CID 170476606) is 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol.
What is the SMILES notation for 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol?
The canonical SMILES for 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol is Nc1c(F)cc(F)cc1C=CCCO.
What is the InChIKey of 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol?
The InChIKey is FKJABYSGAYXOAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO/c11-8-5-7(3-1-2-4-14)10(13)9(12)6-8/h1,3,5-6,14H,2,4,13H2.
What are the key properties of 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol?
4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol has a molecular weight of 199.20 g/mol, XLogP of 1.94, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-3,5-difluorophenyl)but-3-en-1-ol is sourced from PubChem (CID 170476606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).