C11H14FNO — CID 170476550
4-(4-amino-5-fluoro-2-methylphenyl)but-3-en-1-ol (PubChem CID 170476550) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 4-(4-amino-5-fluoro-2-methylphenyl)but-3-en-1-ol.
| Compound Name | 4-(4-amino-5-fluoro-2-methylphenyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 170476550 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 4-(4-amino-5-fluoro-2-methylphenyl)but-3-en-1-ol |
| SMILES | Cc1cc(N)c(F)cc1C=CCCO |
| InChI | InChI=1S/C11H14FNO/c1-8-6-11(13)10(12)7-9(8)4-2-3-5-14/h2,4,6-7,14H,3,5,13H2,1H3 |
| InChIKey | NLBBVZOLKKECLD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|