C10H11F2NS — CID 170478364
4-(5-amino-2,4-difluorophenyl)but-3-ene-1-thiol (PubChem CID 170478364) has the molecular formula C10H11F2NS and a molecular weight of 215.27 g/mol. Its IUPAC name is 4-(5-amino-2,4-difluorophenyl)but-3-ene-1-thiol.
| Compound Name | 4-(5-amino-2,4-difluorophenyl)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170478364 |
| Molecular Formula | C10H11F2NS |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-(5-amino-2,4-difluorophenyl)but-3-ene-1-thiol |
| SMILES | Nc1cc(C=CCCS)c(F)cc1F |
| InChI | InChI=1S/C10H11F2NS/c11-8-6-9(12)10(13)5-7(8)3-1-2-4-14/h1,3,5-6,14H,2,4,13H2 |
| InChIKey | SPOPVCPSYQMAAO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|