C12H15FOS — CID 170478614
4-(4-ethoxy-2-fluorophenyl)but-3-ene-1-thiol (PubChem CID 170478614) has the molecular formula C12H15FOS and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(4-ethoxy-2-fluorophenyl)but-3-ene-1-thiol.
| Compound Name | 4-(4-ethoxy-2-fluorophenyl)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170478614 |
| Molecular Formula | C12H15FOS |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-(4-ethoxy-2-fluorophenyl)but-3-ene-1-thiol |
| SMILES | CCOc1ccc(C=CCCS)c(F)c1 |
| InChI | InChI=1S/C12H15FOS/c1-2-14-11-7-6-10(12(13)9-11)5-3-4-8-15/h3,5-7,9,15H,2,4,8H2,1H3 |
| InChIKey | YJQQQKQQBRUJHA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|