C10H9F3S — CID 170478114
4-(2,4,5-trifluorophenyl)but-3-ene-1-thiol (PubChem CID 170478114) has the molecular formula C10H9F3S and a molecular weight of 218.24 g/mol. Its IUPAC name is 4-(2,4,5-trifluorophenyl)but-3-ene-1-thiol.
| Compound Name | 4-(2,4,5-trifluorophenyl)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170478114 |
| Molecular Formula | C10H9F3S |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 4-(2,4,5-trifluorophenyl)but-3-ene-1-thiol |
| SMILES | Fc1cc(F)c(C=CCCS)cc1F |
| InChI | InChI=1S/C10H9F3S/c11-8-6-10(13)9(12)5-7(8)3-1-2-4-14/h1,3,5-6,14H,2,4H2 |
| InChIKey | JWYJFUSTZWORPC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|