C10H7F3O — CID 118296236
(E)-4-(2,4,5-trifluorophenyl)but-3-enal (PubChem CID 118296236) has the molecular formula C10H7F3O and a molecular weight of 200.16 g/mol. Its IUPAC name is (E)-4-(2,4,5-trifluorophenyl)but-3-enal.
| Compound Name | (E)-4-(2,4,5-trifluorophenyl)but-3-enal |
|---|---|
| PubChem CID | 118296236 |
| Molecular Formula | C10H7F3O |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | (E)-4-(2,4,5-trifluorophenyl)but-3-enal |
| SMILES | O=CC/C=C/c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H7F3O/c11-8-6-10(13)9(12)5-7(8)3-1-2-4-14/h1,3-6H,2H2/b3-1+ |
| InChIKey | DFBUINWPWTVINE-HNQUOIGGSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|