About (E)-4-(2,4,5-trifluorophenyl)but-3-enal
(E)-4-(2,4,5-trifluorophenyl)but-3-enal (PubChem CID 118296236) has the molecular formula C10H7F3O
and a molecular weight of 200.16 g/mol. Its IUPAC name is (E)-4-(2,4,5-trifluorophenyl)but-3-enal.
Molecular Properties
| Compound Name | (E)-4-(2,4,5-trifluorophenyl)but-3-enal |
| PubChem CID | 118296236 |
| Molecular Formula | C10H7F3O |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | (E)-4-(2,4,5-trifluorophenyl)but-3-enal |
| SMILES | O=CC/C=C/c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H7F3O/c11-8-6-10(13)9(12)5-7(8)3-1-2-4-14/h1,3-6H,2H2/b3-1+ |
| InChIKey | DFBUINWPWTVINE-HNQUOIGGSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(2,4,5-trifluorophenyl)but-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2,4,5-trifluorophenyl)but-3-enal?
The IUPAC name of (E)-4-(2,4,5-trifluorophenyl)but-3-enal (CID 118296236) is (E)-4-(2,4,5-trifluorophenyl)but-3-enal.
What is the SMILES notation for (E)-4-(2,4,5-trifluorophenyl)but-3-enal?
The canonical SMILES for (E)-4-(2,4,5-trifluorophenyl)but-3-enal is O=CC/C=C/c1cc(F)c(F)cc1F.
What is the InChIKey of (E)-4-(2,4,5-trifluorophenyl)but-3-enal?
The InChIKey is DFBUINWPWTVINE-HNQUOIGGSA-N. The full InChI is InChI=1S/C10H7F3O/c11-8-6-10(13)9(12)5-7(8)3-1-2-4-14/h1,3-6H,2H2/b3-1+.
What are the key properties of (E)-4-(2,4,5-trifluorophenyl)but-3-enal?
(E)-4-(2,4,5-trifluorophenyl)but-3-enal has a molecular weight of 200.16 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2,4,5-trifluorophenyl)but-3-enal is sourced from PubChem (CID 118296236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).