C11H9BrF2O — CID 170497757
4-(4-bromobut-1-enyl)-2,5-difluorobenzaldehyde (PubChem CID 170497757) has the molecular formula C11H9BrF2O and a molecular weight of 275.09 g/mol. Its IUPAC name is 4-(4-bromobut-1-enyl)-2,5-difluorobenzaldehyde.
| Compound Name | 4-(4-bromobut-1-enyl)-2,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 170497757 |
| Molecular Formula | C11H9BrF2O |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 4-(4-bromobut-1-enyl)-2,5-difluorobenzaldehyde |
| SMILES | O=Cc1cc(F)c(C=CCCBr)cc1F |
| InChI | InChI=1S/C11H9BrF2O/c12-4-2-1-3-8-5-11(14)9(7-15)6-10(8)13/h1,3,5-7H,2,4H2 |
| InChIKey | RBYSBTNOTPHAPL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|