C10H8BrClF2 — CID 170497258
1-(4-bromobut-1-enyl)-3-chloro-2,4-difluorobenzene (PubChem CID 170497258) has the molecular formula C10H8BrClF2 and a molecular weight of 281.53 g/mol. Its IUPAC name is 1-(4-bromobut-1-enyl)-3-chloro-2,4-difluorobenzene.
| Compound Name | 1-(4-bromobut-1-enyl)-3-chloro-2,4-difluorobenzene |
|---|---|
| PubChem CID | 170497258 |
| Molecular Formula | C10H8BrClF2 |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | 1-(4-bromobut-1-enyl)-3-chloro-2,4-difluorobenzene |
| SMILES | Fc1ccc(C=CCCBr)c(F)c1Cl |
| InChI | InChI=1S/C10H8BrClF2/c11-6-2-1-3-7-4-5-8(13)9(12)10(7)14/h1,3-5H,2,6H2 |
| InChIKey | DUOLALWDQIETLI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|