C9H8BrCl2N — CID 170498497
4-(4-bromobut-1-enyl)-2,3-dichloropyridine (PubChem CID 170498497) has the molecular formula C9H8BrCl2N and a molecular weight of 280.98 g/mol. Its IUPAC name is 4-(4-bromobut-1-enyl)-2,3-dichloropyridine.
| Compound Name | 4-(4-bromobut-1-enyl)-2,3-dichloropyridine |
|---|---|
| PubChem CID | 170498497 |
| Molecular Formula | C9H8BrCl2N |
| Molecular Weight | 280.98 g/mol |
| Exact Mass | 278.92 |
| IUPAC Name | 4-(4-bromobut-1-enyl)-2,3-dichloropyridine |
| SMILES | Clc1nccc(C=CCCBr)c1Cl |
| InChI | InChI=1S/C9H8BrCl2N/c10-5-2-1-3-7-4-6-13-9(12)8(7)11/h1,3-4,6H,2,5H2 |
| InChIKey | LECVJNPAXLMFNC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.98 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|