C11H11BrF2 — CID 170497285
1-(4-bromobut-1-enyl)-3,4-difluoro-2-methylbenzene (PubChem CID 170497285) has the molecular formula C11H11BrF2 and a molecular weight of 261.11 g/mol. Its IUPAC name is 1-(4-bromobut-1-enyl)-3,4-difluoro-2-methylbenzene.
| Compound Name | 1-(4-bromobut-1-enyl)-3,4-difluoro-2-methylbenzene |
|---|---|
| PubChem CID | 170497285 |
| Molecular Formula | C11H11BrF2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 1-(4-bromobut-1-enyl)-3,4-difluoro-2-methylbenzene |
| SMILES | Cc1c(C=CCCBr)ccc(F)c1F |
| InChI | InChI=1S/C11H11BrF2/c1-8-9(4-2-3-7-12)5-6-10(13)11(8)14/h2,4-6H,3,7H2,1H3 |
| InChIKey | PDPHGSSBWGCYPB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|