C11H10F2O — CID 170481694
4-(3,4-difluoro-2-methylphenyl)but-3-enal (PubChem CID 170481694) has the molecular formula C11H10F2O and a molecular weight of 196.20 g/mol. Its IUPAC name is 4-(3,4-difluoro-2-methylphenyl)but-3-enal.
| Compound Name | 4-(3,4-difluoro-2-methylphenyl)but-3-enal |
|---|---|
| PubChem CID | 170481694 |
| Molecular Formula | C11H10F2O |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4-(3,4-difluoro-2-methylphenyl)but-3-enal |
| SMILES | Cc1c(C=CCC=O)ccc(F)c1F |
| InChI | InChI=1S/C11H10F2O/c1-8-9(4-2-3-7-14)5-6-10(12)11(8)13/h2,4-7H,3H2,1H3 |
| InChIKey | WGTLIAHMTCRXAJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|