C12H15BrO — CID 170497372
[4-(4-bromobut-1-enyl)-3-methylphenyl]methanol (PubChem CID 170497372) has the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. Its IUPAC name is [4-(4-bromobut-1-enyl)-3-methylphenyl]methanol.
| Compound Name | [4-(4-bromobut-1-enyl)-3-methylphenyl]methanol |
|---|---|
| PubChem CID | 170497372 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | [4-(4-bromobut-1-enyl)-3-methylphenyl]methanol |
| SMILES | Cc1cc(CO)ccc1C=CCCBr |
| InChI | InChI=1S/C12H15BrO/c1-10-8-11(9-14)5-6-12(10)4-2-3-7-13/h2,4-6,8,14H,3,7,9H2,1H3 |
| InChIKey | MXTUABCMDLHDJF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|