C13H17BrO3 — CID 170498292
[4-(4-bromobut-1-enyl)-3,5-dimethoxyphenyl]methanol (PubChem CID 170498292) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is [4-(4-bromobut-1-enyl)-3,5-dimethoxyphenyl]methanol.
| Compound Name | [4-(4-bromobut-1-enyl)-3,5-dimethoxyphenyl]methanol |
|---|---|
| PubChem CID | 170498292 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | [4-(4-bromobut-1-enyl)-3,5-dimethoxyphenyl]methanol |
| SMILES | COc1cc(CO)cc(OC)c1C=CCCBr |
| InChI | InChI=1S/C13H17BrO3/c1-16-12-7-10(9-15)8-13(17-2)11(12)5-3-4-6-14/h3,5,7-8,15H,4,6,9H2,1-2H3 |
| InChIKey | YYSUGVVMEZOCJS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|