C13H17BrO — CID 106681551
2-[(E)-4-bromobut-1-enyl]-1-methoxy-3,5-dimethylbenzene (PubChem CID 106681551) has the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. Its IUPAC name is 2-[(E)-4-bromobut-1-enyl]-1-methoxy-3,5-dimethylbenzene.
| Compound Name | 2-[(E)-4-bromobut-1-enyl]-1-methoxy-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 106681551 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-[(E)-4-bromobut-1-enyl]-1-methoxy-3,5-dimethylbenzene |
| SMILES | COc1cc(C)cc(C)c1/C=C/CCBr |
| InChI | InChI=1S/C13H17BrO/c1-10-8-11(2)12(6-4-5-7-14)13(9-10)15-3/h4,6,8-9H,5,7H2,1-3H3/b6-4+ |
| InChIKey | GDWGZGMDEMFUTB-GQCTYLIASA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|