C11H16BrNO — CID 115261763
N-(bromomethyl)-2-methoxy-N,4,6-trimethylaniline (PubChem CID 115261763) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is N-(bromomethyl)-2-methoxy-N,4,6-trimethylaniline.
| Compound Name | N-(bromomethyl)-2-methoxy-N,4,6-trimethylaniline |
|---|---|
| PubChem CID | 115261763 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N-(bromomethyl)-2-methoxy-N,4,6-trimethylaniline |
| SMILES | COc1cc(C)cc(C)c1N(C)CBr |
| InChI | InChI=1S/C11H16BrNO/c1-8-5-9(2)11(13(3)7-12)10(6-8)14-4/h5-6H,7H2,1-4H3 |
| InChIKey | ALHJPFZSZNLWLS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|