C13H21NOS — CID 115224772
3-(2-methoxy-N,4,6-trimethylanilino)propane-1-thiol (PubChem CID 115224772) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is 3-(2-methoxy-N,4,6-trimethylanilino)propane-1-thiol.
| Compound Name | 3-(2-methoxy-N,4,6-trimethylanilino)propane-1-thiol |
|---|---|
| PubChem CID | 115224772 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3-(2-methoxy-N,4,6-trimethylanilino)propane-1-thiol |
| SMILES | COc1cc(C)cc(C)c1N(C)CCCS |
| InChI | InChI=1S/C13H21NOS/c1-10-8-11(2)13(12(9-10)15-4)14(3)6-5-7-16/h8-9,16H,5-7H2,1-4H3 |
| InChIKey | NCGVXHHUPBRLBQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|