C11H17NOS — CID 115227745
(2-methoxy-N,4,5-trimethylanilino)methanethiol (PubChem CID 115227745) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is (2-methoxy-N,4,5-trimethylanilino)methanethiol.
| Compound Name | (2-methoxy-N,4,5-trimethylanilino)methanethiol |
|---|---|
| PubChem CID | 115227745 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (2-methoxy-N,4,5-trimethylanilino)methanethiol |
| SMILES | COc1cc(C)c(C)cc1N(C)CS |
| InChI | InChI=1S/C11H17NOS/c1-8-5-10(12(3)7-14)11(13-4)6-9(8)2/h5-6,14H,7H2,1-4H3 |
| InChIKey | VYWZIVJNJCMAJO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|