C13H21NO3 — CID 115121985
3-(2-methoxy-N,4,5-trimethylanilino)propane-1,2-diol (PubChem CID 115121985) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 3-(2-methoxy-N,4,5-trimethylanilino)propane-1,2-diol.
| Compound Name | 3-(2-methoxy-N,4,5-trimethylanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 115121985 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-(2-methoxy-N,4,5-trimethylanilino)propane-1,2-diol |
| SMILES | COc1cc(C)c(C)cc1N(C)CC(O)CO |
| InChI | InChI=1S/C13H21NO3/c1-9-5-12(13(17-4)6-10(9)2)14(3)7-11(16)8-15/h5-6,11,15-16H,7-8H2,1-4H3 |
| InChIKey | NMMGPRMIDNOVOI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |