C12H20N2O2 — CID 115120374
2-amino-3-(2-methoxy-N,5-dimethylanilino)propan-1-ol (PubChem CID 115120374) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-amino-3-(2-methoxy-N,5-dimethylanilino)propan-1-ol.
| Compound Name | 2-amino-3-(2-methoxy-N,5-dimethylanilino)propan-1-ol |
|---|---|
| PubChem CID | 115120374 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-amino-3-(2-methoxy-N,5-dimethylanilino)propan-1-ol |
| SMILES | COc1ccc(C)cc1N(C)CC(N)CO |
| InChI | InChI=1S/C12H20N2O2/c1-9-4-5-12(16-3)11(6-9)14(2)7-10(13)8-15/h4-6,10,15H,7-8,13H2,1-3H3 |
| InChIKey | ZLINUHHSMBATSR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |