C11H17NO — CID 58577971
N-ethyl-2-methoxy-N,5-dimethylaniline (PubChem CID 58577971) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-ethyl-2-methoxy-N,5-dimethylaniline.
| Compound Name | N-ethyl-2-methoxy-N,5-dimethylaniline |
|---|---|
| PubChem CID | 58577971 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-ethyl-2-methoxy-N,5-dimethylaniline |
| SMILES | CCN(C)c1cc(C)ccc1OC |
| InChI | InChI=1S/C11H17NO/c1-5-12(3)10-8-9(2)6-7-11(10)13-4/h6-8H,5H2,1-4H3 |
| InChIKey | WELDUQWQEXNLRL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |