About N-ethyl-2-methoxy-N,4-dimethylaniline
N-ethyl-2-methoxy-N,4-dimethylaniline (PubChem CID 90305517) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is N-ethyl-2-methoxy-N,4-dimethylaniline.
Molecular Properties
| Compound Name | N-ethyl-2-methoxy-N,4-dimethylaniline |
| PubChem CID | 90305517 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-ethyl-2-methoxy-N,4-dimethylaniline |
| SMILES | CCN(C)c1ccc(C)cc1OC |
| InChI | InChI=1S/C11H17NO/c1-5-12(3)10-7-6-9(2)8-11(10)13-4/h6-8H,5H2,1-4H3 |
| InChIKey | QIIWYLIRTWBXFN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2-methoxy-N,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methoxy-N,4-dimethylaniline?
The IUPAC name of N-ethyl-2-methoxy-N,4-dimethylaniline (CID 90305517) is N-ethyl-2-methoxy-N,4-dimethylaniline.
What is the SMILES notation for N-ethyl-2-methoxy-N,4-dimethylaniline?
The canonical SMILES for N-ethyl-2-methoxy-N,4-dimethylaniline is CCN(C)c1ccc(C)cc1OC.
What is the InChIKey of N-ethyl-2-methoxy-N,4-dimethylaniline?
The InChIKey is QIIWYLIRTWBXFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-5-12(3)10-7-6-9(2)8-11(10)13-4/h6-8H,5H2,1-4H3.
What are the key properties of N-ethyl-2-methoxy-N,4-dimethylaniline?
N-ethyl-2-methoxy-N,4-dimethylaniline has a molecular weight of 179.26 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methoxy-N,4-dimethylaniline is sourced from PubChem (CID 90305517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).